C10H13F3N4O2S — CID 138523071
ethyl 2-methylsulfanyl-4-[2-(2,2,2-trifluoroethyl)hydrazinyl]pyrimidine-5-carboxylate (PubChem CID 138523071) has the molecular formula C10H13F3N4O2S and a molecular weight of 310.30 g/mol. Its IUPAC name is ethyl 2-methylsulfanyl-4-[2-(2,2,2-trifluoroethyl)hydrazinyl]pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-methylsulfanyl-4-[2-(2,2,2-trifluoroethyl)hydrazinyl]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 138523071 |
| Molecular Formula | C10H13F3N4O2S |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | ethyl 2-methylsulfanyl-4-[2-(2,2,2-trifluoroethyl)hydrazinyl]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(SC)nc1NNCC(F)(F)F |
| InChI | InChI=1S/C10H13F3N4O2S/c1-3-19-8(18)6-4-14-9(20-2)16-7(6)17-15-5-10(11,12)13/h4,15H,3,5H2,1-2H3,(H,14,16,17) |
| InChIKey | ANWNZDGJEZWUQN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|