About [(1S)-2-(butanoylamino)-1-(3,4-dimethoxyphenyl)ethyl] (E)-3-phenylprop-2-enoate
[(1S)-2-(butanoylamino)-1-(3,4-dimethoxyphenyl)ethyl] (E)-3-phenylprop-2-enoate (PubChem CID 138523268) has the molecular formula C23H27NO5
and a molecular weight of 397.47 g/mol. Its IUPAC name is [(1S)-2-(butanoylamino)-1-(3,4-dimethoxyphenyl)ethyl] (E)-3-phenylprop-2-enoate.
Molecular Properties
| Compound Name | [(1S)-2-(butanoylamino)-1-(3,4-dimethoxyphenyl)ethyl] (E)-3-phenylprop-2-enoate |
| PubChem CID | 138523268 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | [(1S)-2-(butanoylamino)-1-(3,4-dimethoxyphenyl)ethyl] (E)-3-phenylprop-2-enoate |
| SMILES | CCCC(=O)NC[C@@H](OC(=O)/C=C/c1ccccc1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C23H27NO5/c1-4-8-22(25)24-16-21(18-12-13-19(27-2)20(15-18)28-3)29-23(26)14-11-17-9-6-5-7-10-17/h5-7,9-15,21H,4,8,16H2,1-3H3,(H,24,25)/b14-11+/t21-/m1/s1 |
| InChIKey | MCPTXEOEQFDQIO-QGFLDLQWSA-N |
| XLogP | 3.92 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-2-(butanoylamino)-1-(3,4-dimethoxyphenyl)ethyl] (E)-3-phenylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-2-(butanoylamino)-1-(3,4-dimethoxyphenyl)ethyl] (E)-3-phenylprop-2-enoate?
The IUPAC name of [(1S)-2-(butanoylamino)-1-(3,4-dimethoxyphenyl)ethyl] (E)-3-phenylprop-2-enoate (CID 138523268) is [(1S)-2-(butanoylamino)-1-(3,4-dimethoxyphenyl)ethyl] (E)-3-phenylprop-2-enoate.
What is the SMILES notation for [(1S)-2-(butanoylamino)-1-(3,4-dimethoxyphenyl)ethyl] (E)-3-phenylprop-2-enoate?
The canonical SMILES for [(1S)-2-(butanoylamino)-1-(3,4-dimethoxyphenyl)ethyl] (E)-3-phenylprop-2-enoate is CCCC(=O)NC[C@@H](OC(=O)/C=C/c1ccccc1)c1ccc(OC)c(OC)c1.
What is the InChIKey of [(1S)-2-(butanoylamino)-1-(3,4-dimethoxyphenyl)ethyl] (E)-3-phenylprop-2-enoate?
The InChIKey is MCPTXEOEQFDQIO-QGFLDLQWSA-N. The full InChI is InChI=1S/C23H27NO5/c1-4-8-22(25)24-16-21(18-12-13-19(27-2)20(15-18)28-3)29-23(26)14-11-17-9-6-5-7-10-17/h5-7,9-15,21H,4,8,16H2,1-3H3,(H,24,25)/b14-11+/t21-/m1/s1.
What are the key properties of [(1S)-2-(butanoylamino)-1-(3,4-dimethoxyphenyl)ethyl] (E)-3-phenylprop-2-enoate?
[(1S)-2-(butanoylamino)-1-(3,4-dimethoxyphenyl)ethyl] (E)-3-phenylprop-2-enoate has a molecular weight of 397.47 g/mol, XLogP of 3.92, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-2-(butanoylamino)-1-(3,4-dimethoxyphenyl)ethyl] (E)-3-phenylprop-2-enoate is sourced from PubChem (CID 138523268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).