C15H27NO6 — CID 138523296
(2R)-2-[(2S,3R,4S)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxy-N-nonylacetamide (PubChem CID 138523296) has the molecular formula C15H27NO6 and a molecular weight of 317.38 g/mol. Its IUPAC name is (2R)-2-[(2S,3R,4S)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxy-N-nonylacetamide.
| Compound Name | (2R)-2-[(2S,3R,4S)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxy-N-nonylacetamide |
|---|---|
| PubChem CID | 138523296 |
| Molecular Formula | C15H27NO6 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | (2R)-2-[(2S,3R,4S)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxy-N-nonylacetamide |
| SMILES | CCCCCCCCCNC(=O)[C@H](O)[C@H]1OC(=O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C15H27NO6/c1-2-3-4-5-6-7-8-9-16-14(20)12(19)13-10(17)11(18)15(21)22-13/h10-13,17-19H,2-9H2,1H3,(H,16,20)/t10-,11+,12-,13+/m1/s1 |
| InChIKey | OIXRMJMLFXWFKH-XQHKEYJVSA-N |
| XLogP | -0.14 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|