C24H31NO2 — CID 138523478
7a-methyl-3,5-bis(2-phenylpropyl)-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazole (PubChem CID 138523478) has the molecular formula C24H31NO2 and a molecular weight of 365.52 g/mol. Its IUPAC name is 7a-methyl-3,5-bis(2-phenylpropyl)-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazole.
| Compound Name | 7a-methyl-3,5-bis(2-phenylpropyl)-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazole |
|---|---|
| PubChem CID | 138523478 |
| Molecular Formula | C24H31NO2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | 7a-methyl-3,5-bis(2-phenylpropyl)-1,3,5,7-tetrahydro-[1,3]oxazolo[3,4-c][1,3]oxazole |
| SMILES | CC(CC1OCC2(C)COC(CC(C)c3ccccc3)N12)c1ccccc1 |
| InChI | InChI=1S/C24H31NO2/c1-18(20-10-6-4-7-11-20)14-22-25-23(27-17-24(25,3)16-26-22)15-19(2)21-12-8-5-9-13-21/h4-13,18-19,22-23H,14-17H2,1-3H3 |
| InChIKey | DQFGDIHRHZTTGH-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |