C22H32N6O4 — CID 138523911
3-amino-4-[(2S,3S)-1,4-diamino-4-(2-amino-4-carbamoylphenyl)-2,3-diethoxybutyl]benzamide (PubChem CID 138523911) has the molecular formula C22H32N6O4 and a molecular weight of 444.54 g/mol. Its IUPAC name is 3-amino-4-[(2S,3S)-1,4-diamino-4-(2-amino-4-carbamoylphenyl)-2,3-diethoxybutyl]benzamide.
| Compound Name | 3-amino-4-[(2S,3S)-1,4-diamino-4-(2-amino-4-carbamoylphenyl)-2,3-diethoxybutyl]benzamide |
|---|---|
| PubChem CID | 138523911 |
| Molecular Formula | C22H32N6O4 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | 3-amino-4-[(2S,3S)-1,4-diamino-4-(2-amino-4-carbamoylphenyl)-2,3-diethoxybutyl]benzamide |
| SMILES | CCO[C@@H](C(N)c1ccc(C(N)=O)cc1N)[C@@H](OCC)C(N)c1ccc(C(N)=O)cc1N |
| InChI | InChI=1S/C22H32N6O4/c1-3-31-19(17(25)13-7-5-11(21(27)29)9-15(13)23)20(32-4-2)18(26)14-8-6-12(22(28)30)10-16(14)24/h5-10,17-20H,3-4,23-26H2,1-2H3,(H2,27,29)(H2,28,30)/t17?,18?,19-,20-/m0/s1 |
| InChIKey | RIKCEYLNAIPOOO-GUMHCPJTSA-N |
| XLogP | 0.56 |
| TPSA | 208.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|