C22H30N4O6 — CID 138524245
(2S)-2-aminooxy-2-[(2R)-6-[1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]pyrazol-4-yl]-3,4-dihydro-2H-chromen-2-yl]acetic acid (PubChem CID 138524245) has the molecular formula C22H30N4O6 and a molecular weight of 446.50 g/mol. Its IUPAC name is (2S)-2-aminooxy-2-[(2R)-6-[1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]pyrazol-4-yl]-3,4-dihydro-2H-chromen-2-yl]acetic acid.
| Compound Name | (2S)-2-aminooxy-2-[(2R)-6-[1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]pyrazol-4-yl]-3,4-dihydro-2H-chromen-2-yl]acetic acid |
|---|---|
| PubChem CID | 138524245 |
| Molecular Formula | C22H30N4O6 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | (2S)-2-aminooxy-2-[(2R)-6-[1-[3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]pyrazol-4-yl]-3,4-dihydro-2H-chromen-2-yl]acetic acid |
| SMILES | CC(C)(C)OC(=O)NCCCn1cc(-c2ccc3c(c2)CC[C@H]([C@H](ON)C(=O)O)O3)cn1 |
| InChI | InChI=1S/C22H30N4O6/c1-22(2,3)31-21(29)24-9-4-10-26-13-16(12-25-26)14-5-7-17-15(11-14)6-8-18(30-17)19(32-23)20(27)28/h5,7,11-13,18-19H,4,6,8-10,23H2,1-3H3,(H,24,29)(H,27,28)/t18-,19+/m1/s1 |
| InChIKey | DWAVLYMKPWBIKJ-MOPGFXCFSA-N |
| XLogP | 2.50 |
| TPSA | 137.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|