C21H20FN7O3S — CID 138525396
2-[(3R,4S)-3-fluoro-1-(2-hydroxyacetyl)piperidin-4-yl]oxy-5-[4-[(2-methyl-1,3-thiazol-5-yl)amino]-1,3,5-triazin-2-yl]benzonitrile (PubChem CID 138525396) has the molecular formula C21H20FN7O3S and a molecular weight of 469.50 g/mol. Its IUPAC name is 2-[(3R,4S)-3-fluoro-1-(2-hydroxyacetyl)piperidin-4-yl]oxy-5-[4-[(2-methyl-1,3-thiazol-5-yl)amino]-1,3,5-triazin-2-yl]benzonitrile.
| Compound Name | 2-[(3R,4S)-3-fluoro-1-(2-hydroxyacetyl)piperidin-4-yl]oxy-5-[4-[(2-methyl-1,3-thiazol-5-yl)amino]-1,3,5-triazin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 138525396 |
| Molecular Formula | C21H20FN7O3S |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | 2-[(3R,4S)-3-fluoro-1-(2-hydroxyacetyl)piperidin-4-yl]oxy-5-[4-[(2-methyl-1,3-thiazol-5-yl)amino]-1,3,5-triazin-2-yl]benzonitrile |
| SMILES | Cc1ncc(Nc2ncnc(-c3ccc(O[C@H]4CCN(C(=O)CO)C[C@H]4F)c(C#N)c3)n2)s1 |
| InChI | InChI=1S/C21H20FN7O3S/c1-12-24-8-18(33-12)27-21-26-11-25-20(28-21)13-2-3-16(14(6-13)7-23)32-17-4-5-29(9-15(17)22)19(31)10-30/h2-3,6,8,11,15,17,30H,4-5,9-10H2,1H3,(H,25,26,27,28)/t15-,17+/m1/s1 |
| InChIKey | XGJGUJSSRHZXEN-WBVHZDCISA-N |
| XLogP | 2.23 |
| TPSA | 137.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |