C16H20O2 — CID 138525497
(1R,12R)-8,8-dimethyl-15-oxatetracyclo[10.2.1.01,5.07,11]pentadeca-7(11),13-dien-10-one (PubChem CID 138525497) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is (1R,12R)-8,8-dimethyl-15-oxatetracyclo[10.2.1.01,5.07,11]pentadeca-7(11),13-dien-10-one.
| Compound Name | (1R,12R)-8,8-dimethyl-15-oxatetracyclo[10.2.1.01,5.07,11]pentadeca-7(11),13-dien-10-one |
|---|---|
| PubChem CID | 138525497 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | (1R,12R)-8,8-dimethyl-15-oxatetracyclo[10.2.1.01,5.07,11]pentadeca-7(11),13-dien-10-one |
| SMILES | CC1(C)CC(=O)C2=C1CC1CCC[C@]13C=C[C@H]2O3 |
| InChI | InChI=1S/C16H20O2/c1-15(2)9-12(17)14-11(15)8-10-4-3-6-16(10)7-5-13(14)18-16/h5,7,10,13H,3-4,6,8-9H2,1-2H3/t10?,13-,16+/m1/s1 |
| InChIKey | GTGWWODZYYCCFE-BVPGBDNSSA-N |
| XLogP | 3.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|