C23H25N7O2 — CID 138525738
2-(2-methoxyethylamino)-N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]quinoline-7-carboxamide (PubChem CID 138525738) has the molecular formula C23H25N7O2 and a molecular weight of 431.50 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]quinoline-7-carboxamide.
| Compound Name | 2-(2-methoxyethylamino)-N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]quinoline-7-carboxamide |
|---|---|
| PubChem CID | 138525738 |
| Molecular Formula | C23H25N7O2 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 2-(2-methoxyethylamino)-N-[6-(4-propan-2-yl-1,2,4-triazol-3-yl)-2-pyridinyl]quinoline-7-carboxamide |
| SMILES | COCCNc1ccc2ccc(C(=O)Nc3cccc(-c4nncn4C(C)C)n3)cc2n1 |
| InChI | InChI=1S/C23H25N7O2/c1-15(2)30-14-25-29-22(30)18-5-4-6-21(26-18)28-23(31)17-8-7-16-9-10-20(24-11-12-32-3)27-19(16)13-17/h4-10,13-15H,11-12H2,1-3H3,(H,24,27)(H,26,28,31) |
| InChIKey | PQDIFAJFVTZPPE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 106.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|