About 2-ethyl-1-propan-2-yl-3a,7a-dihydrobenzimidazole
2-ethyl-1-propan-2-yl-3a,7a-dihydrobenzimidazole (PubChem CID 138525825) has the molecular formula C12H18N2
and a molecular weight of 190.29 g/mol. Its IUPAC name is 2-ethyl-1-propan-2-yl-3a,7a-dihydrobenzimidazole.
Molecular Properties
| Compound Name | 2-ethyl-1-propan-2-yl-3a,7a-dihydrobenzimidazole |
| PubChem CID | 138525825 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 2-ethyl-1-propan-2-yl-3a,7a-dihydrobenzimidazole |
| SMILES | CCC1=NC2C=CC=CC2N1C(C)C |
| InChI | InChI=1S/C12H18N2/c1-4-12-13-10-7-5-6-8-11(10)14(12)9(2)3/h5-11H,4H2,1-3H3 |
| InChIKey | LNNUMEPIOWIQGO-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-1-propan-2-yl-3a,7a-dihydrobenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1-propan-2-yl-3a,7a-dihydrobenzimidazole?
The IUPAC name of 2-ethyl-1-propan-2-yl-3a,7a-dihydrobenzimidazole (CID 138525825) is 2-ethyl-1-propan-2-yl-3a,7a-dihydrobenzimidazole.
What is the SMILES notation for 2-ethyl-1-propan-2-yl-3a,7a-dihydrobenzimidazole?
The canonical SMILES for 2-ethyl-1-propan-2-yl-3a,7a-dihydrobenzimidazole is CCC1=NC2C=CC=CC2N1C(C)C.
What is the InChIKey of 2-ethyl-1-propan-2-yl-3a,7a-dihydrobenzimidazole?
The InChIKey is LNNUMEPIOWIQGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2/c1-4-12-13-10-7-5-6-8-11(10)14(12)9(2)3/h5-11H,4H2,1-3H3.
What are the key properties of 2-ethyl-1-propan-2-yl-3a,7a-dihydrobenzimidazole?
2-ethyl-1-propan-2-yl-3a,7a-dihydrobenzimidazole has a molecular weight of 190.29 g/mol, XLogP of 2.38, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1-propan-2-yl-3a,7a-dihydrobenzimidazole is sourced from PubChem (CID 138525825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).