About 5-amino-1,1-difluoro-5-methylhexane-2,4-dione
5-amino-1,1-difluoro-5-methylhexane-2,4-dione (PubChem CID 138525988) has the molecular formula C7H11F2NO2
and a molecular weight of 179.17 g/mol. Its IUPAC name is 5-amino-1,1-difluoro-5-methylhexane-2,4-dione.
Molecular Properties
| Compound Name | 5-amino-1,1-difluoro-5-methylhexane-2,4-dione |
| PubChem CID | 138525988 |
| Molecular Formula | C7H11F2NO2 |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | 5-amino-1,1-difluoro-5-methylhexane-2,4-dione |
| SMILES | CC(C)(N)C(=O)CC(=O)C(F)F |
| InChI | InChI=1S/C7H11F2NO2/c1-7(2,10)5(12)3-4(11)6(8)9/h6H,3,10H2,1-2H3 |
| InChIKey | CNDSHVZUBMMGJT-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-1,1-difluoro-5-methylhexane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1,1-difluoro-5-methylhexane-2,4-dione?
The IUPAC name of 5-amino-1,1-difluoro-5-methylhexane-2,4-dione (CID 138525988) is 5-amino-1,1-difluoro-5-methylhexane-2,4-dione.
What is the SMILES notation for 5-amino-1,1-difluoro-5-methylhexane-2,4-dione?
The canonical SMILES for 5-amino-1,1-difluoro-5-methylhexane-2,4-dione is CC(C)(N)C(=O)CC(=O)C(F)F.
What is the InChIKey of 5-amino-1,1-difluoro-5-methylhexane-2,4-dione?
The InChIKey is CNDSHVZUBMMGJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F2NO2/c1-7(2,10)5(12)3-4(11)6(8)9/h6H,3,10H2,1-2H3.
What are the key properties of 5-amino-1,1-difluoro-5-methylhexane-2,4-dione?
5-amino-1,1-difluoro-5-methylhexane-2,4-dione has a molecular weight of 179.17 g/mol, XLogP of 0.52, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1,1-difluoro-5-methylhexane-2,4-dione is sourced from PubChem (CID 138525988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).