C26H27FN8O5 — CID 138526233
1-(2,4-dihydroxy-5-propan-2-ylbenzenecarboximidoyl)-1-[1-[2-[(5-fluoro-2-oxo-1H-pyrimidin-6-yl)carbamoylamino]ethyl]indol-5-yl]urea (PubChem CID 138526233) has the molecular formula C26H27FN8O5 and a molecular weight of 550.55 g/mol. Its IUPAC name is 1-(2,4-dihydroxy-5-propan-2-ylbenzenecarboximidoyl)-1-[1-[2-[(5-fluoro-2-oxo-1H-pyrimidin-6-yl)carbamoylamino]ethyl]indol-5-yl]urea.
| Compound Name | 1-(2,4-dihydroxy-5-propan-2-ylbenzenecarboximidoyl)-1-[1-[2-[(5-fluoro-2-oxo-1H-pyrimidin-6-yl)carbamoylamino]ethyl]indol-5-yl]urea |
|---|---|
| PubChem CID | 138526233 |
| Molecular Formula | C26H27FN8O5 |
| Molecular Weight | 550.55 g/mol |
| Exact Mass | 550.21 |
| IUPAC Name | 1-(2,4-dihydroxy-5-propan-2-ylbenzenecarboximidoyl)-1-[1-[2-[(5-fluoro-2-oxo-1H-pyrimidin-6-yl)carbamoylamino]ethyl]indol-5-yl]urea |
| SMILES | [H]/N=C(\c1cc(C(C)C)c(O)cc1O)N(C(N)=O)c1ccc2c(ccn2CCNC(=O)Nc2[nH]c(=O)ncc2F)c1 |
| InChI | InChI=1S/C26H27FN8O5/c1-13(2)16-10-17(21(37)11-20(16)36)22(28)35(24(29)38)15-3-4-19-14(9-15)5-7-34(19)8-6-30-25(39)32-23-18(27)12-31-26(40)33-23/h3-5,7,9-13,28,36-37H,6,8H2,1-2H3,(H2,29,38)(H3,30,31,32,33,39,40)/b28-22+ |
| InChIKey | HTGRYPOYUXQGMM-XAYXJRQQSA-N |
| XLogP | 3.13 |
| TPSA | 202.45 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.55 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|