C16H31N — CID 138526483
N,N,3-trimethyl-5-(2,2,3-trimethylcyclopent-3-en-1-yl)pentan-2-amine (PubChem CID 138526483) has the molecular formula C16H31N and a molecular weight of 237.43 g/mol. Its IUPAC name is N,N,3-trimethyl-5-(2,2,3-trimethylcyclopent-3-en-1-yl)pentan-2-amine.
| Compound Name | N,N,3-trimethyl-5-(2,2,3-trimethylcyclopent-3-en-1-yl)pentan-2-amine |
|---|---|
| PubChem CID | 138526483 |
| Molecular Formula | C16H31N |
| Molecular Weight | 237.43 g/mol |
| Exact Mass | 237.25 |
| IUPAC Name | N,N,3-trimethyl-5-(2,2,3-trimethylcyclopent-3-en-1-yl)pentan-2-amine |
| SMILES | CC1=CCC(CCC(C)C(C)N(C)C)C1(C)C |
| InChI | InChI=1S/C16H31N/c1-12(14(3)17(6)7)8-10-15-11-9-13(2)16(15,4)5/h9,12,14-15H,8,10-11H2,1-7H3 |
| InChIKey | RDDLBJFLAXAISZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|