About N-ethyl-2-fluoro-3,3-dimethyl-2-(1-methylcyclopropyl)butan-1-amine
N-ethyl-2-fluoro-3,3-dimethyl-2-(1-methylcyclopropyl)butan-1-amine (PubChem CID 138526512) has the molecular formula C12H24FN
and a molecular weight of 201.33 g/mol. Its IUPAC name is N-ethyl-2-fluoro-3,3-dimethyl-2-(1-methylcyclopropyl)butan-1-amine.
Molecular Properties
| Compound Name | N-ethyl-2-fluoro-3,3-dimethyl-2-(1-methylcyclopropyl)butan-1-amine |
| PubChem CID | 138526512 |
| Molecular Formula | C12H24FN |
| Molecular Weight | 201.33 g/mol |
| Exact Mass | 201.19 |
| IUPAC Name | N-ethyl-2-fluoro-3,3-dimethyl-2-(1-methylcyclopropyl)butan-1-amine |
| SMILES | CCNCC(F)(C(C)(C)C)C1(C)CC1 |
| InChI | InChI=1S/C12H24FN/c1-6-14-9-12(13,10(2,3)4)11(5)7-8-11/h14H,6-9H2,1-5H3 |
| InChIKey | DNWCXPLIPVNJBF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-ethyl-2-fluoro-3,3-dimethyl-2-(1-methylcyclopropyl)butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2-fluoro-3,3-dimethyl-2-(1-methylcyclopropyl)butan-1-amine?
The IUPAC name of N-ethyl-2-fluoro-3,3-dimethyl-2-(1-methylcyclopropyl)butan-1-amine (CID 138526512) is N-ethyl-2-fluoro-3,3-dimethyl-2-(1-methylcyclopropyl)butan-1-amine.
What is the SMILES notation for N-ethyl-2-fluoro-3,3-dimethyl-2-(1-methylcyclopropyl)butan-1-amine?
The canonical SMILES for N-ethyl-2-fluoro-3,3-dimethyl-2-(1-methylcyclopropyl)butan-1-amine is CCNCC(F)(C(C)(C)C)C1(C)CC1.
What is the InChIKey of N-ethyl-2-fluoro-3,3-dimethyl-2-(1-methylcyclopropyl)butan-1-amine?
The InChIKey is DNWCXPLIPVNJBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24FN/c1-6-14-9-12(13,10(2,3)4)11(5)7-8-11/h14H,6-9H2,1-5H3.
What are the key properties of N-ethyl-2-fluoro-3,3-dimethyl-2-(1-methylcyclopropyl)butan-1-amine?
N-ethyl-2-fluoro-3,3-dimethyl-2-(1-methylcyclopropyl)butan-1-amine has a molecular weight of 201.33 g/mol, XLogP of 3.15, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2-fluoro-3,3-dimethyl-2-(1-methylcyclopropyl)butan-1-amine is sourced from PubChem (CID 138526512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).