C21H27NO — CID 138527114
[4-(1,5-dimethyl-3-tricyclo[5.3.1.03,9]undecanyl)-2-methylphenyl] cyanate (PubChem CID 138527114) has the molecular formula C21H27NO and a molecular weight of 309.45 g/mol. Its IUPAC name is [4-(1,5-dimethyl-3-tricyclo[5.3.1.03,9]undecanyl)-2-methylphenyl] cyanate.
| Compound Name | [4-(1,5-dimethyl-3-tricyclo[5.3.1.03,9]undecanyl)-2-methylphenyl] cyanate |
|---|---|
| PubChem CID | 138527114 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | [4-(1,5-dimethyl-3-tricyclo[5.3.1.03,9]undecanyl)-2-methylphenyl] cyanate |
| SMILES | Cc1cc(C23CC(C)CC4CC2CC(C)(C4)C3)ccc1OC#N |
| InChI | InChI=1S/C21H27NO/c1-14-6-16-8-18-11-20(3,10-16)12-21(18,9-14)17-4-5-19(23-13-22)15(2)7-17/h4-5,7,14,16,18H,6,8-12H2,1-3H3 |
| InChIKey | DXRZQBCRMLFOLK-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|