C13H18F2N2 — CID 138527391
(3E,5E)-6-amino-3-(1,1-difluoroethyl)-7-methyl-2-methylidenenona-3,5-dienenitrile (PubChem CID 138527391) has the molecular formula C13H18F2N2 and a molecular weight of 240.30 g/mol. Its IUPAC name is (3E,5E)-6-amino-3-(1,1-difluoroethyl)-7-methyl-2-methylidenenona-3,5-dienenitrile.
| Compound Name | (3E,5E)-6-amino-3-(1,1-difluoroethyl)-7-methyl-2-methylidenenona-3,5-dienenitrile |
|---|---|
| PubChem CID | 138527391 |
| Molecular Formula | C13H18F2N2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | (3E,5E)-6-amino-3-(1,1-difluoroethyl)-7-methyl-2-methylidenenona-3,5-dienenitrile |
| SMILES | C=C(C#N)/C(=C\C=C(\N)C(C)CC)C(C)(F)F |
| InChI | InChI=1S/C13H18F2N2/c1-5-9(2)12(17)7-6-11(10(3)8-16)13(4,14)15/h6-7,9H,3,5,17H2,1-2,4H3/b11-6+,12-7+ |
| InChIKey | OYBWLRDXXTYGAS-GNXRPPCSSA-N |
| XLogP | 3.54 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|