C13H20F3N — CID 138527422
(4E,6E)-N,3,8-trimethyl-7-(trifluoromethyl)nona-4,6,8-trien-4-amine (PubChem CID 138527422) has the molecular formula C13H20F3N and a molecular weight of 247.30 g/mol. Its IUPAC name is (4E,6E)-N,3,8-trimethyl-7-(trifluoromethyl)nona-4,6,8-trien-4-amine.
| Compound Name | (4E,6E)-N,3,8-trimethyl-7-(trifluoromethyl)nona-4,6,8-trien-4-amine |
|---|---|
| PubChem CID | 138527422 |
| Molecular Formula | C13H20F3N |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | (4E,6E)-N,3,8-trimethyl-7-(trifluoromethyl)nona-4,6,8-trien-4-amine |
| SMILES | C=C(C)/C(=C\C=C(\NC)C(C)CC)C(F)(F)F |
| InChI | InChI=1S/C13H20F3N/c1-6-10(4)12(17-5)8-7-11(9(2)3)13(14,15)16/h7-8,10,17H,2,6H2,1,3-5H3/b11-7+,12-8+ |
| InChIKey | QCSXMLBRCAWNCM-MKICQXMISA-N |
| XLogP | 4.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|