C14H23F2N — CID 138527474
(3E,5E)-6-(1,1-difluoroethyl)-9-methyl-7-methylidenedeca-3,5-dien-3-amine (PubChem CID 138527474) has the molecular formula C14H23F2N and a molecular weight of 243.34 g/mol. Its IUPAC name is (3E,5E)-6-(1,1-difluoroethyl)-9-methyl-7-methylidenedeca-3,5-dien-3-amine.
| Compound Name | (3E,5E)-6-(1,1-difluoroethyl)-9-methyl-7-methylidenedeca-3,5-dien-3-amine |
|---|---|
| PubChem CID | 138527474 |
| Molecular Formula | C14H23F2N |
| Molecular Weight | 243.34 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | (3E,5E)-6-(1,1-difluoroethyl)-9-methyl-7-methylidenedeca-3,5-dien-3-amine |
| SMILES | C=C(CC(C)C)/C(=C\C=C(\N)CC)C(C)(F)F |
| InChI | InChI=1S/C14H23F2N/c1-6-12(17)7-8-13(14(5,15)16)11(4)9-10(2)3/h7-8,10H,4,6,9,17H2,1-3,5H3/b12-7+,13-8+ |
| InChIKey | IBYJZFBZNALSAW-INOXDZRUSA-N |
| XLogP | 4.42 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.34 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|