About 2-N'-methyl-1,3-oxazinane-2,2,3-triamine
2-N'-methyl-1,3-oxazinane-2,2,3-triamine (PubChem CID 138527517) has the molecular formula C5H14N4O
and a molecular weight of 146.19 g/mol. Its IUPAC name is 2-N'-methyl-1,3-oxazinane-2,2,3-triamine.
Molecular Properties
| Compound Name | 2-N'-methyl-1,3-oxazinane-2,2,3-triamine |
| PubChem CID | 138527517 |
| Molecular Formula | C5H14N4O |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.12 |
| IUPAC Name | 2-N'-methyl-1,3-oxazinane-2,2,3-triamine |
| SMILES | CNC1(N)OCCCN1N |
| InChI | InChI=1S/C5H14N4O/c1-8-5(6)9(7)3-2-4-10-5/h8H,2-4,6-7H2,1H3 |
| InChIKey | ZKCATXFGMBRUMW-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 76.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 2-N'-methyl-1,3-oxazinane-2,2,3-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N'-methyl-1,3-oxazinane-2,2,3-triamine?
The IUPAC name of 2-N'-methyl-1,3-oxazinane-2,2,3-triamine (CID 138527517) is 2-N'-methyl-1,3-oxazinane-2,2,3-triamine.
What is the SMILES notation for 2-N'-methyl-1,3-oxazinane-2,2,3-triamine?
The canonical SMILES for 2-N'-methyl-1,3-oxazinane-2,2,3-triamine is CNC1(N)OCCCN1N.
What is the InChIKey of 2-N'-methyl-1,3-oxazinane-2,2,3-triamine?
The InChIKey is ZKCATXFGMBRUMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14N4O/c1-8-5(6)9(7)3-2-4-10-5/h8H,2-4,6-7H2,1H3.
What are the key properties of 2-N'-methyl-1,3-oxazinane-2,2,3-triamine?
2-N'-methyl-1,3-oxazinane-2,2,3-triamine has a molecular weight of 146.19 g/mol, XLogP of -1.63, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N'-methyl-1,3-oxazinane-2,2,3-triamine is sourced from PubChem (CID 138527517), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).