About 6-methyl-2,5-dihydro-1H-pyridin-6-amine
6-methyl-2,5-dihydro-1H-pyridin-6-amine (PubChem CID 138527537) has the molecular formula C6H12N2
and a molecular weight of 112.18 g/mol. Its IUPAC name is 6-methyl-2,5-dihydro-1H-pyridin-6-amine.
Molecular Properties
| Compound Name | 6-methyl-2,5-dihydro-1H-pyridin-6-amine |
| PubChem CID | 138527537 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | 6-methyl-2,5-dihydro-1H-pyridin-6-amine |
| SMILES | CC1(N)CC=CCN1 |
| InChI | InChI=1S/C6H12N2/c1-6(7)4-2-3-5-8-6/h2-3,8H,4-5,7H2,1H3 |
| InChIKey | MYYBOKRSVIEWBH-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-2,5-dihydro-1H-pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-2,5-dihydro-1H-pyridin-6-amine?
The IUPAC name of 6-methyl-2,5-dihydro-1H-pyridin-6-amine (CID 138527537) is 6-methyl-2,5-dihydro-1H-pyridin-6-amine.
What is the SMILES notation for 6-methyl-2,5-dihydro-1H-pyridin-6-amine?
The canonical SMILES for 6-methyl-2,5-dihydro-1H-pyridin-6-amine is CC1(N)CC=CCN1.
What is the InChIKey of 6-methyl-2,5-dihydro-1H-pyridin-6-amine?
The InChIKey is MYYBOKRSVIEWBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2/c1-6(7)4-2-3-5-8-6/h2-3,8H,4-5,7H2,1H3.
What are the key properties of 6-methyl-2,5-dihydro-1H-pyridin-6-amine?
6-methyl-2,5-dihydro-1H-pyridin-6-amine has a molecular weight of 112.18 g/mol, XLogP of 0.21, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-2,5-dihydro-1H-pyridin-6-amine is sourced from PubChem (CID 138527537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).