C10H18N4 — CID 138527605
(1Z,5Z)-3-N,4-N-dimethyl-1,6-bis(methylideneamino)hexa-1,5-diene-3,4-diamine (PubChem CID 138527605) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is (1Z,5Z)-3-N,4-N-dimethyl-1,6-bis(methylideneamino)hexa-1,5-diene-3,4-diamine.
| Compound Name | (1Z,5Z)-3-N,4-N-dimethyl-1,6-bis(methylideneamino)hexa-1,5-diene-3,4-diamine |
|---|---|
| PubChem CID | 138527605 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | (1Z,5Z)-3-N,4-N-dimethyl-1,6-bis(methylideneamino)hexa-1,5-diene-3,4-diamine |
| SMILES | C=N/C=C\C(NC)C(/C=C\N=C)NC |
| InChI | InChI=1S/C10H18N4/c1-11-7-5-9(13-3)10(14-4)6-8-12-2/h5-10,13-14H,1-2H2,3-4H3/b7-5-,8-6- |
| InChIKey | YKVHZSQFVAHSHR-SFECMWDFSA-N |
| XLogP | 0.59 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|