C18H29N — CID 138528062
(3E,5Z)-N-[(1E,3Z)-4,5-dimethylhexa-1,3,5-trienyl]-6,7-dimethylocta-3,5-dien-4-amine (PubChem CID 138528062) has the molecular formula C18H29N and a molecular weight of 259.44 g/mol. Its IUPAC name is (3E,5Z)-N-[(1E,3Z)-4,5-dimethylhexa-1,3,5-trienyl]-6,7-dimethylocta-3,5-dien-4-amine.
| Compound Name | (3E,5Z)-N-[(1E,3Z)-4,5-dimethylhexa-1,3,5-trienyl]-6,7-dimethylocta-3,5-dien-4-amine |
|---|---|
| PubChem CID | 138528062 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | (3E,5Z)-N-[(1E,3Z)-4,5-dimethylhexa-1,3,5-trienyl]-6,7-dimethylocta-3,5-dien-4-amine |
| SMILES | C=C(C)/C(C)=C\C=C\NC(/C=C(/C)C(C)C)=C/CC |
| InChI | InChI=1S/C18H29N/c1-8-10-18(13-17(7)15(4)5)19-12-9-11-16(6)14(2)3/h9-13,15,19H,2,8H2,1,3-7H3/b12-9+,16-11-,17-13-,18-10+ |
| InChIKey | UBNARXNTUAAPPG-GBCUWJRWSA-N |
| XLogP | 5.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|