C26H31N7O3 — CID 138528149
N,N'-diamino-N-[5-[10-[2-(4-methyl-1-oxo-3H-2-benzofuran-5-yl)ethyl]-9,10-diazatricyclo[4.2.1.12,5]decane-9-carbonyl]-2-pyridinyl]methanimidamide (PubChem CID 138528149) has the molecular formula C26H31N7O3 and a molecular weight of 489.58 g/mol. Its IUPAC name is N,N'-diamino-N-[5-[10-[2-(4-methyl-1-oxo-3H-2-benzofuran-5-yl)ethyl]-9,10-diazatricyclo[4.2.1.12,5]decane-9-carbonyl]-2-pyridinyl]methanimidamide.
| Compound Name | N,N'-diamino-N-[5-[10-[2-(4-methyl-1-oxo-3H-2-benzofuran-5-yl)ethyl]-9,10-diazatricyclo[4.2.1.12,5]decane-9-carbonyl]-2-pyridinyl]methanimidamide |
|---|---|
| PubChem CID | 138528149 |
| Molecular Formula | C26H31N7O3 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | N,N'-diamino-N-[5-[10-[2-(4-methyl-1-oxo-3H-2-benzofuran-5-yl)ethyl]-9,10-diazatricyclo[4.2.1.12,5]decane-9-carbonyl]-2-pyridinyl]methanimidamide |
| SMILES | Cc1c(CCN2C3CCC2C2CCC3N2C(=O)c2ccc(N(N)/C=N\N)nc2)ccc2c1COC2=O |
| InChI | InChI=1S/C26H31N7O3/c1-15-16(2-4-18-19(15)13-36-26(18)35)10-11-31-20-5-6-21(31)23-8-7-22(20)33(23)25(34)17-3-9-24(29-12-17)32(28)14-30-27/h2-4,9,12,14,20-23H,5-8,10-11,13,27-28H2,1H3/b30-14- |
| InChIKey | NPZZEFPRMADTKH-CPDSRJINSA-N |
| XLogP | 1.71 |
| TPSA | 130.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|