C17H28N2 — CID 138528196
(4Z,6E)-2-methylidene-9-methylimino-N-propan-2-yl-4-[(Z)-prop-1-enyl]nona-4,6-dien-1-amine (PubChem CID 138528196) has the molecular formula C17H28N2 and a molecular weight of 260.43 g/mol. Its IUPAC name is (4Z,6E)-2-methylidene-9-methylimino-N-propan-2-yl-4-[(Z)-prop-1-enyl]nona-4,6-dien-1-amine.
| Compound Name | (4Z,6E)-2-methylidene-9-methylimino-N-propan-2-yl-4-[(Z)-prop-1-enyl]nona-4,6-dien-1-amine |
|---|---|
| PubChem CID | 138528196 |
| Molecular Formula | C17H28N2 |
| Molecular Weight | 260.43 g/mol |
| Exact Mass | 260.23 |
| IUPAC Name | (4Z,6E)-2-methylidene-9-methylimino-N-propan-2-yl-4-[(Z)-prop-1-enyl]nona-4,6-dien-1-amine |
| SMILES | C=C(CNC(C)C)CC(/C=C\C)=C/C=C/C/C=N/C |
| InChI | InChI=1S/C17H28N2/c1-6-10-17(11-8-7-9-12-18-5)13-16(4)14-19-15(2)3/h6-8,10-12,15,19H,4,9,13-14H2,1-3,5H3/b8-7+,10-6-,17-11+,18-12+ |
| InChIKey | NGJXPQISRQKFJL-HVJUUGTRSA-N |
| XLogP | 4.08 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|