C32H53N5 — CID 138528305
(1E,3E,5Z)-3-ethynyl-N,N,N',5-tetramethyl-2-(2-methyl-3-methyliminopropyl)-N'-[(Z)-4-[[2-methyl-3-(2-methylpropylamino)but-3-enylidene]amino]but-3-en-2-yl]octa-1,3,5-triene-1,8-diamine (PubChem CID 138528305) has the molecular formula C32H53N5 and a molecular weight of 507.81 g/mol. Its IUPAC name is (1E,3E,5Z)-3-ethynyl-N,N,N',5-tetramethyl-2-(2-methyl-3-methyliminopropyl)-N'-[(Z)-4-[[2-methyl-3-(2-methylpropylamino)but-3-enylidene]amino]but-3-en-2-yl]octa-1,3,5-triene-1,8-diamine.
| Compound Name | (1E,3E,5Z)-3-ethynyl-N,N,N',5-tetramethyl-2-(2-methyl-3-methyliminopropyl)-N'-[(Z)-4-[[2-methyl-3-(2-methylpropylamino)but-3-enylidene]amino]but-3-en-2-yl]octa-1,3,5-triene-1,8-diamine |
|---|---|
| PubChem CID | 138528305 |
| Molecular Formula | C32H53N5 |
| Molecular Weight | 507.81 g/mol |
| Exact Mass | 507.43 |
| IUPAC Name | (1E,3E,5Z)-3-ethynyl-N,N,N',5-tetramethyl-2-(2-methyl-3-methyliminopropyl)-N'-[(Z)-4-[[2-methyl-3-(2-methylpropylamino)but-3-enylidene]amino]but-3-en-2-yl]octa-1,3,5-triene-1,8-diamine |
| SMILES | C#CC(=C\C(C)=C/CCN(C)C(C)/C=C\N=C\C(C)C(=C)NCC(C)C)/C(=C/N(C)C)CC(C)/C=N/C |
| InChI | InChI=1S/C32H53N5/c1-13-31(32(24-36(10)11)20-27(5)22-33-9)19-26(4)15-14-18-37(12)29(7)16-17-34-23-28(6)30(8)35-21-25(2)3/h1,15-17,19,22-25,27-29,35H,8,14,18,20-21H2,2-7,9-12H3/b17-16-,26-15-,31-19+,32-24+,33-22+,34-23+ |
| InChIKey | GNOKDBSZRFNXCK-SVHYYLBTSA-N |
| XLogP | 6.35 |
| TPSA | 43.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.81 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|