C19H32N2 — CID 138528326
(1Z,4Z,5Z)-4-ethylidene-2-(3-ethyliminopropyl)-6-methyl-N-prop-2-enylocta-1,5-dien-1-amine (PubChem CID 138528326) has the molecular formula C19H32N2 and a molecular weight of 288.48 g/mol. Its IUPAC name is (1Z,4Z,5Z)-4-ethylidene-2-(3-ethyliminopropyl)-6-methyl-N-prop-2-enylocta-1,5-dien-1-amine.
| Compound Name | (1Z,4Z,5Z)-4-ethylidene-2-(3-ethyliminopropyl)-6-methyl-N-prop-2-enylocta-1,5-dien-1-amine |
|---|---|
| PubChem CID | 138528326 |
| Molecular Formula | C19H32N2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.26 |
| IUPAC Name | (1Z,4Z,5Z)-4-ethylidene-2-(3-ethyliminopropyl)-6-methyl-N-prop-2-enylocta-1,5-dien-1-amine |
| SMILES | C=CCN/C=C(/CC/C=N/CC)CC(/C=C(/C)CC)=C/C |
| InChI | InChI=1S/C19H32N2/c1-6-12-21-16-19(11-10-13-20-9-4)15-18(8-3)14-17(5)7-2/h6,8,13-14,16,21H,1,7,9-12,15H2,2-5H3/b17-14-,18-8+,19-16-,20-13+ |
| InChIKey | XFFJKYSSDHYVHR-NNPGQRNASA-N |
| XLogP | 5.21 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|