C21H22FN — CID 138528334
(2Z,4Z)-3-[1-(4-fluoro-3-methylphenyl)ethenyl]-N-[(E)-pent-2-en-4-ynyl]hepta-2,4,6-trien-2-amine (PubChem CID 138528334) has the molecular formula C21H22FN and a molecular weight of 307.41 g/mol. Its IUPAC name is (2Z,4Z)-3-[1-(4-fluoro-3-methylphenyl)ethenyl]-N-[(E)-pent-2-en-4-ynyl]hepta-2,4,6-trien-2-amine.
| Compound Name | (2Z,4Z)-3-[1-(4-fluoro-3-methylphenyl)ethenyl]-N-[(E)-pent-2-en-4-ynyl]hepta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 138528334 |
| Molecular Formula | C21H22FN |
| Molecular Weight | 307.41 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | (2Z,4Z)-3-[1-(4-fluoro-3-methylphenyl)ethenyl]-N-[(E)-pent-2-en-4-ynyl]hepta-2,4,6-trien-2-amine |
| SMILES | C#C/C=C/CN/C(C)=C(/C=C\C=C)C(=C)c1ccc(F)c(C)c1 |
| InChI | InChI=1S/C21H22FN/c1-6-8-10-14-23-18(5)20(11-9-7-2)17(4)19-12-13-21(22)16(3)15-19/h1,7-13,15,23H,2,4,14H2,3,5H3/b10-8+,11-9-,20-18- |
| InChIKey | CPBGOXWQUYEFLR-WBUPLDIASA-N |
| XLogP | 4.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.41 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|