C18H27FN2 — CID 138528342
(4Z)-6-N-ethenyl-2-N-[(2E,4E)-5-fluoro-2-[(E)-prop-1-enyl]hexa-2,4-dienyl]hepta-1,4-diene-2,6-diamine (PubChem CID 138528342) has the molecular formula C18H27FN2 and a molecular weight of 290.43 g/mol. Its IUPAC name is (4Z)-6-N-ethenyl-2-N-[(2E,4E)-5-fluoro-2-[(E)-prop-1-enyl]hexa-2,4-dienyl]hepta-1,4-diene-2,6-diamine.
| Compound Name | (4Z)-6-N-ethenyl-2-N-[(2E,4E)-5-fluoro-2-[(E)-prop-1-enyl]hexa-2,4-dienyl]hepta-1,4-diene-2,6-diamine |
|---|---|
| PubChem CID | 138528342 |
| Molecular Formula | C18H27FN2 |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | (4Z)-6-N-ethenyl-2-N-[(2E,4E)-5-fluoro-2-[(E)-prop-1-enyl]hexa-2,4-dienyl]hepta-1,4-diene-2,6-diamine |
| SMILES | C=CNC(C)/C=C\CC(=C)NCC(/C=C/C)=C/C=C(\C)F |
| InChI | InChI=1S/C18H27FN2/c1-6-9-18(13-12-15(3)19)14-21-17(5)11-8-10-16(4)20-7-2/h6-10,12-13,16,20-21H,2,5,11,14H2,1,3-4H3/b9-6+,10-8-,15-12+,18-13+ |
| InChIKey | YQUYPGVVZNGZGC-BXDWUSKVSA-N |
| XLogP | 4.53 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|