C19H25FN5P — CID 138528451
N'-[(E)-2-[5-[1-[[5-(1-fluoro-1-phosphanylethyl)pyrazin-2-yl]amino]ethyl]cyclohepta-1,3,6-trien-1-yl]ethenyl]ethanimidamide (PubChem CID 138528451) has the molecular formula C19H25FN5P and a molecular weight of 373.42 g/mol. Its IUPAC name is N'-[(E)-2-[5-[1-[[5-(1-fluoro-1-phosphanylethyl)pyrazin-2-yl]amino]ethyl]cyclohepta-1,3,6-trien-1-yl]ethenyl]ethanimidamide.
| Compound Name | N'-[(E)-2-[5-[1-[[5-(1-fluoro-1-phosphanylethyl)pyrazin-2-yl]amino]ethyl]cyclohepta-1,3,6-trien-1-yl]ethenyl]ethanimidamide |
|---|---|
| PubChem CID | 138528451 |
| Molecular Formula | C19H25FN5P |
| Molecular Weight | 373.42 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | N'-[(E)-2-[5-[1-[[5-(1-fluoro-1-phosphanylethyl)pyrazin-2-yl]amino]ethyl]cyclohepta-1,3,6-trien-1-yl]ethenyl]ethanimidamide |
| SMILES | C/C(N)=N\C=C\C1=CC=CC(C(C)Nc2cnc(C(C)(F)P)cn2)C=C1 |
| InChI | InChI=1S/C19H25FN5P/c1-13(25-18-12-23-17(11-24-18)19(3,20)26)16-6-4-5-15(7-8-16)9-10-22-14(2)21/h4-13,16H,26H2,1-3H3,(H2,21,22)(H,24,25)/b10-9+ |
| InChIKey | JENKPUOMPWSJFZ-MDZDMXLPSA-N |
| XLogP | 3.85 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|