C12H20N2 — CID 138528721
(2E,4E)-5-(ethylamino)-2,3-dimethylocta-2,4-dienenitrile (PubChem CID 138528721) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is (2E,4E)-5-(ethylamino)-2,3-dimethylocta-2,4-dienenitrile.
| Compound Name | (2E,4E)-5-(ethylamino)-2,3-dimethylocta-2,4-dienenitrile |
|---|---|
| PubChem CID | 138528721 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | (2E,4E)-5-(ethylamino)-2,3-dimethylocta-2,4-dienenitrile |
| SMILES | CCC/C(=C\C(C)=C(/C)C#N)NCC |
| InChI | InChI=1S/C12H20N2/c1-5-7-12(14-6-2)8-10(3)11(4)9-13/h8,14H,5-7H2,1-4H3/b11-10+,12-8+ |
| InChIKey | TYFIBOZKTYLBHS-HKCCEGKBSA-N |
| XLogP | 3.14 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|