C19H22F3N5O3S — CID 138528823
2,2,2-trifluoro-1-[4-[4-[3-[[2-methoxyethyl(methyl)amino]methyl]azetidin-1-yl]-2,1,3-benzoxadiazol-6-yl]-1,3-thiazol-2-yl]ethanol (PubChem CID 138528823) has the molecular formula C19H22F3N5O3S and a molecular weight of 457.48 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[4-[4-[3-[[2-methoxyethyl(methyl)amino]methyl]azetidin-1-yl]-2,1,3-benzoxadiazol-6-yl]-1,3-thiazol-2-yl]ethanol.
| Compound Name | 2,2,2-trifluoro-1-[4-[4-[3-[[2-methoxyethyl(methyl)amino]methyl]azetidin-1-yl]-2,1,3-benzoxadiazol-6-yl]-1,3-thiazol-2-yl]ethanol |
|---|---|
| PubChem CID | 138528823 |
| Molecular Formula | C19H22F3N5O3S |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | 2,2,2-trifluoro-1-[4-[4-[3-[[2-methoxyethyl(methyl)amino]methyl]azetidin-1-yl]-2,1,3-benzoxadiazol-6-yl]-1,3-thiazol-2-yl]ethanol |
| SMILES | COCCN(C)CC1CN(c2cc(-c3csc(C(O)C(F)(F)F)n3)cc3nonc23)C1 |
| InChI | InChI=1S/C19H22F3N5O3S/c1-26(3-4-29-2)7-11-8-27(9-11)15-6-12(5-13-16(15)25-30-24-13)14-10-31-18(23-14)17(28)19(20,21)22/h5-6,10-11,17,28H,3-4,7-9H2,1-2H3 |
| InChIKey | NFJDFVARKYFUKL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 87.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |