About 2-iodo-3-methyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid
2-iodo-3-methyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid (PubChem CID 138531773) has the molecular formula C9H11IO5
and a molecular weight of 326.09 g/mol. Its IUPAC name is 2-iodo-3-methyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid.
Molecular Properties
| Compound Name | 2-iodo-3-methyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
| PubChem CID | 138531773 |
| Molecular Formula | C9H11IO5 |
| Molecular Weight | 326.09 g/mol |
| Exact Mass | 325.97 |
| IUPAC Name | 2-iodo-3-methyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid |
| SMILES | CC1(C(=O)O)C2CCC(O2)C1(I)C(=O)O |
| InChI | InChI=1S/C9H11IO5/c1-8(6(11)12)4-2-3-5(15-4)9(8,10)7(13)14/h4-5H,2-3H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | VOHSYIUPFYMUOP-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.09 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-iodo-3-methyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodo-3-methyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid?
The IUPAC name of 2-iodo-3-methyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid (CID 138531773) is 2-iodo-3-methyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid.
What is the SMILES notation for 2-iodo-3-methyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid?
The canonical SMILES for 2-iodo-3-methyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid is CC1(C(=O)O)C2CCC(O2)C1(I)C(=O)O.
What is the InChIKey of 2-iodo-3-methyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid?
The InChIKey is VOHSYIUPFYMUOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11IO5/c1-8(6(11)12)4-2-3-5(15-4)9(8,10)7(13)14/h4-5H,2-3H2,1H3,(H,11,12)(H,13,14).
What are the key properties of 2-iodo-3-methyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid?
2-iodo-3-methyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid has a molecular weight of 326.09 g/mol, XLogP of 0.90, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodo-3-methyl-7-oxabicyclo[2.2.1]heptane-2,3-dicarboxylic acid is sourced from PubChem (CID 138531773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).