C19H18Cl5NO3S — CID 138531910
2,2,2-trichloroethyl N-[(1S,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-N-methylsulfamate (PubChem CID 138531910) has the molecular formula C19H18Cl5NO3S and a molecular weight of 517.69 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-[(1S,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-N-methylsulfamate.
| Compound Name | 2,2,2-trichloroethyl N-[(1S,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-N-methylsulfamate |
|---|---|
| PubChem CID | 138531910 |
| Molecular Formula | C19H18Cl5NO3S |
| Molecular Weight | 517.69 g/mol |
| Exact Mass | 514.95 |
| IUPAC Name | 2,2,2-trichloroethyl N-[(1S,4S)-4-(3,4-dichlorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl]-N-methylsulfamate |
| SMILES | CN([C@H]1CC[C@@H](c2ccc(Cl)c(Cl)c2)c2ccccc21)S(=O)(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C19H18Cl5NO3S/c1-25(29(26,27)28-11-19(22,23)24)18-9-7-13(14-4-2-3-5-15(14)18)12-6-8-16(20)17(21)10-12/h2-6,8,10,13,18H,7,9,11H2,1H3/t13-,18-/m0/s1 |
| InChIKey | WZCGPJDFCTXAND-UGSOOPFHSA-N |
| XLogP | 6.52 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.69 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|