C22H20F2N2O3 — CID 138532237
4-[6-butyl-3-(3,5-difluoro-4-methoxyphenyl)pyrazin-2-yl]benzoic acid (PubChem CID 138532237) has the molecular formula C22H20F2N2O3 and a molecular weight of 398.41 g/mol. Its IUPAC name is 4-[6-butyl-3-(3,5-difluoro-4-methoxyphenyl)pyrazin-2-yl]benzoic acid.
| Compound Name | 4-[6-butyl-3-(3,5-difluoro-4-methoxyphenyl)pyrazin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 138532237 |
| Molecular Formula | C22H20F2N2O3 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 4-[6-butyl-3-(3,5-difluoro-4-methoxyphenyl)pyrazin-2-yl]benzoic acid |
| SMILES | CCCCc1cnc(-c2cc(F)c(OC)c(F)c2)c(-c2ccc(C(=O)O)cc2)n1 |
| InChI | InChI=1S/C22H20F2N2O3/c1-3-4-5-16-12-25-19(15-10-17(23)21(29-2)18(24)11-15)20(26-16)13-6-8-14(9-7-13)22(27)28/h6-12H,3-5H2,1-2H3,(H,27,28) |
| InChIKey | OVEWFXBBWDKZEP-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |