C23H21F2NO4 — CID 138532240
4-[2-(3,5-difluoro-4-methoxyphenyl)-5-(2-ethoxyethyl)-3-pyridinyl]benzoic acid (PubChem CID 138532240) has the molecular formula C23H21F2NO4 and a molecular weight of 413.42 g/mol. Its IUPAC name is 4-[2-(3,5-difluoro-4-methoxyphenyl)-5-(2-ethoxyethyl)-3-pyridinyl]benzoic acid.
| Compound Name | 4-[2-(3,5-difluoro-4-methoxyphenyl)-5-(2-ethoxyethyl)-3-pyridinyl]benzoic acid |
|---|---|
| PubChem CID | 138532240 |
| Molecular Formula | C23H21F2NO4 |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 4-[2-(3,5-difluoro-4-methoxyphenyl)-5-(2-ethoxyethyl)-3-pyridinyl]benzoic acid |
| SMILES | CCOCCc1cnc(-c2cc(F)c(OC)c(F)c2)c(-c2ccc(C(=O)O)cc2)c1 |
| InChI | InChI=1S/C23H21F2NO4/c1-3-30-9-8-14-10-18(15-4-6-16(7-5-15)23(27)28)21(26-13-14)17-11-19(24)22(29-2)20(25)12-17/h4-7,10-13H,3,8-9H2,1-2H3,(H,27,28) |
| InChIKey | AFEDVXVCYNHMFF-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|