C19H32S — CID 138532253
(3Z,5Z)-5-(3,3-dimethylbut-1-en-2-ylsulfanylmethyl)-6,8,8-trimethylnona-1,3,5-triene (PubChem CID 138532253) has the molecular formula C19H32S and a molecular weight of 292.53 g/mol. Its IUPAC name is (3Z,5Z)-5-(3,3-dimethylbut-1-en-2-ylsulfanylmethyl)-6,8,8-trimethylnona-1,3,5-triene.
| Compound Name | (3Z,5Z)-5-(3,3-dimethylbut-1-en-2-ylsulfanylmethyl)-6,8,8-trimethylnona-1,3,5-triene |
|---|---|
| PubChem CID | 138532253 |
| Molecular Formula | C19H32S |
| Molecular Weight | 292.53 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | (3Z,5Z)-5-(3,3-dimethylbut-1-en-2-ylsulfanylmethyl)-6,8,8-trimethylnona-1,3,5-triene |
| SMILES | C=C/C=C\C(CSC(=C)C(C)(C)C)=C(/C)CC(C)(C)C |
| InChI | InChI=1S/C19H32S/c1-10-11-12-17(15(2)13-18(4,5)6)14-20-16(3)19(7,8)9/h10-12H,1,3,13-14H2,2,4-9H3/b12-11-,17-15- |
| InChIKey | KFSNLVKOYQGAHJ-MMHKUDGTSA-N |
| XLogP | 6.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.53 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|