About 4-[2-(3,5-difluoro-4-methoxyphenyl)-5-(4-methoxybutyl)-3-pyridinyl]-2-methylbenzoic acid
4-[2-(3,5-difluoro-4-methoxyphenyl)-5-(4-methoxybutyl)-3-pyridinyl]-2-methylbenzoic acid (PubChem CID 138532324) has the molecular formula C25H25F2NO4
and a molecular weight of 441.47 g/mol. Its IUPAC name is 4-[2-(3,5-difluoro-4-methoxyphenyl)-5-(4-methoxybutyl)-3-pyridinyl]-2-methylbenzoic acid.
Molecular Properties
| Compound Name | 4-[2-(3,5-difluoro-4-methoxyphenyl)-5-(4-methoxybutyl)-3-pyridinyl]-2-methylbenzoic acid |
| PubChem CID | 138532324 |
| Molecular Formula | C25H25F2NO4 |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 4-[2-(3,5-difluoro-4-methoxyphenyl)-5-(4-methoxybutyl)-3-pyridinyl]-2-methylbenzoic acid |
| SMILES | COCCCCc1cnc(-c2cc(F)c(OC)c(F)c2)c(-c2ccc(C(=O)O)c(C)c2)c1 |
| InChI | InChI=1S/C25H25F2NO4/c1-15-10-17(7-8-19(15)25(29)30)20-11-16(6-4-5-9-31-2)14-28-23(20)18-12-21(26)24(32-3)22(27)13-18/h7-8,10-14H,4-6,9H2,1-3H3,(H,29,30) |
| InChIKey | BGEQMRQHUYGXAY-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(3,5-difluoro-4-methoxyphenyl)-5-(4-methoxybutyl)-3-pyridinyl]-2-methylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(3,5-difluoro-4-methoxyphenyl)-5-(4-methoxybutyl)-3-pyridinyl]-2-methylbenzoic acid?
The IUPAC name of 4-[2-(3,5-difluoro-4-methoxyphenyl)-5-(4-methoxybutyl)-3-pyridinyl]-2-methylbenzoic acid (CID 138532324) is 4-[2-(3,5-difluoro-4-methoxyphenyl)-5-(4-methoxybutyl)-3-pyridinyl]-2-methylbenzoic acid.
What is the SMILES notation for 4-[2-(3,5-difluoro-4-methoxyphenyl)-5-(4-methoxybutyl)-3-pyridinyl]-2-methylbenzoic acid?
The canonical SMILES for 4-[2-(3,5-difluoro-4-methoxyphenyl)-5-(4-methoxybutyl)-3-pyridinyl]-2-methylbenzoic acid is COCCCCc1cnc(-c2cc(F)c(OC)c(F)c2)c(-c2ccc(C(=O)O)c(C)c2)c1.
What is the InChIKey of 4-[2-(3,5-difluoro-4-methoxyphenyl)-5-(4-methoxybutyl)-3-pyridinyl]-2-methylbenzoic acid?
The InChIKey is BGEQMRQHUYGXAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25F2NO4/c1-15-10-17(7-8-19(15)25(29)30)20-11-16(6-4-5-9-31-2)14-28-23(20)18-12-21(26)24(32-3)22(27)13-18/h7-8,10-14H,4-6,9H2,1-3H3,(H,29,30).
What are the key properties of 4-[2-(3,5-difluoro-4-methoxyphenyl)-5-(4-methoxybutyl)-3-pyridinyl]-2-methylbenzoic acid?
4-[2-(3,5-difluoro-4-methoxyphenyl)-5-(4-methoxybutyl)-3-pyridinyl]-2-methylbenzoic acid has a molecular weight of 441.47 g/mol, XLogP of 5.68, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(3,5-difluoro-4-methoxyphenyl)-5-(4-methoxybutyl)-3-pyridinyl]-2-methylbenzoic acid is sourced from PubChem (CID 138532324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).