About 2-chloro-4-[3-(3,5-difluoro-4-methoxyphenyl)-6-(3-methoxypropyl)pyrazin-2-yl]benzoic acid
2-chloro-4-[3-(3,5-difluoro-4-methoxyphenyl)-6-(3-methoxypropyl)pyrazin-2-yl]benzoic acid (PubChem CID 138532419) has the molecular formula C22H19ClF2N2O4
and a molecular weight of 448.85 g/mol. Its IUPAC name is 2-chloro-4-[3-(3,5-difluoro-4-methoxyphenyl)-6-(3-methoxypropyl)pyrazin-2-yl]benzoic acid.
Molecular Properties
| Compound Name | 2-chloro-4-[3-(3,5-difluoro-4-methoxyphenyl)-6-(3-methoxypropyl)pyrazin-2-yl]benzoic acid |
| PubChem CID | 138532419 |
| Molecular Formula | C22H19ClF2N2O4 |
| Molecular Weight | 448.85 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 2-chloro-4-[3-(3,5-difluoro-4-methoxyphenyl)-6-(3-methoxypropyl)pyrazin-2-yl]benzoic acid |
| SMILES | COCCCc1cnc(-c2cc(F)c(OC)c(F)c2)c(-c2ccc(C(=O)O)c(Cl)c2)n1 |
| InChI | InChI=1S/C22H19ClF2N2O4/c1-30-7-3-4-14-11-26-19(13-9-17(24)21(31-2)18(25)10-13)20(27-14)12-5-6-15(22(28)29)16(23)8-12/h5-6,8-11H,3-4,7H2,1-2H3,(H,28,29) |
| InChIKey | RSIGIBXXRSPGNK-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 81.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.85 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-[3-(3,5-difluoro-4-methoxyphenyl)-6-(3-methoxypropyl)pyrazin-2-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-[3-(3,5-difluoro-4-methoxyphenyl)-6-(3-methoxypropyl)pyrazin-2-yl]benzoic acid?
The IUPAC name of 2-chloro-4-[3-(3,5-difluoro-4-methoxyphenyl)-6-(3-methoxypropyl)pyrazin-2-yl]benzoic acid (CID 138532419) is 2-chloro-4-[3-(3,5-difluoro-4-methoxyphenyl)-6-(3-methoxypropyl)pyrazin-2-yl]benzoic acid.
What is the SMILES notation for 2-chloro-4-[3-(3,5-difluoro-4-methoxyphenyl)-6-(3-methoxypropyl)pyrazin-2-yl]benzoic acid?
The canonical SMILES for 2-chloro-4-[3-(3,5-difluoro-4-methoxyphenyl)-6-(3-methoxypropyl)pyrazin-2-yl]benzoic acid is COCCCc1cnc(-c2cc(F)c(OC)c(F)c2)c(-c2ccc(C(=O)O)c(Cl)c2)n1.
What is the InChIKey of 2-chloro-4-[3-(3,5-difluoro-4-methoxyphenyl)-6-(3-methoxypropyl)pyrazin-2-yl]benzoic acid?
The InChIKey is RSIGIBXXRSPGNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19ClF2N2O4/c1-30-7-3-4-14-11-26-19(13-9-17(24)21(31-2)18(25)10-13)20(27-14)12-5-6-15(22(28)29)16(23)8-12/h5-6,8-11H,3-4,7H2,1-2H3,(H,28,29).
What are the key properties of 2-chloro-4-[3-(3,5-difluoro-4-methoxyphenyl)-6-(3-methoxypropyl)pyrazin-2-yl]benzoic acid?
2-chloro-4-[3-(3,5-difluoro-4-methoxyphenyl)-6-(3-methoxypropyl)pyrazin-2-yl]benzoic acid has a molecular weight of 448.85 g/mol, XLogP of 5.03, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-[3-(3,5-difluoro-4-methoxyphenyl)-6-(3-methoxypropyl)pyrazin-2-yl]benzoic acid is sourced from PubChem (CID 138532419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).