About 4-[3-[3,4-bis(trifluoromethyl)phenyl]-6-butylpyrazin-2-yl]benzoic acid
4-[3-[3,4-bis(trifluoromethyl)phenyl]-6-butylpyrazin-2-yl]benzoic acid (PubChem CID 138532474) has the molecular formula C23H18F6N2O2
and a molecular weight of 468.40 g/mol. Its IUPAC name is 4-[3-[3,4-bis(trifluoromethyl)phenyl]-6-butylpyrazin-2-yl]benzoic acid.
Molecular Properties
| Compound Name | 4-[3-[3,4-bis(trifluoromethyl)phenyl]-6-butylpyrazin-2-yl]benzoic acid |
| PubChem CID | 138532474 |
| Molecular Formula | C23H18F6N2O2 |
| Molecular Weight | 468.40 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 4-[3-[3,4-bis(trifluoromethyl)phenyl]-6-butylpyrazin-2-yl]benzoic acid |
| SMILES | CCCCc1cnc(-c2ccc(C(F)(F)F)c(C(F)(F)F)c2)c(-c2ccc(C(=O)O)cc2)n1 |
| InChI | InChI=1S/C23H18F6N2O2/c1-2-3-4-16-12-30-19(20(31-16)13-5-7-14(8-6-13)21(32)33)15-9-10-17(22(24,25)26)18(11-15)23(27,28)29/h5-12H,2-4H2,1H3,(H,32,33) |
| InChIKey | CPRVXKSCLWDSDL-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 468.40 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[3-[3,4-bis(trifluoromethyl)phenyl]-6-butylpyrazin-2-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[3,4-bis(trifluoromethyl)phenyl]-6-butylpyrazin-2-yl]benzoic acid?
The IUPAC name of 4-[3-[3,4-bis(trifluoromethyl)phenyl]-6-butylpyrazin-2-yl]benzoic acid (CID 138532474) is 4-[3-[3,4-bis(trifluoromethyl)phenyl]-6-butylpyrazin-2-yl]benzoic acid.
What is the SMILES notation for 4-[3-[3,4-bis(trifluoromethyl)phenyl]-6-butylpyrazin-2-yl]benzoic acid?
The canonical SMILES for 4-[3-[3,4-bis(trifluoromethyl)phenyl]-6-butylpyrazin-2-yl]benzoic acid is CCCCc1cnc(-c2ccc(C(F)(F)F)c(C(F)(F)F)c2)c(-c2ccc(C(=O)O)cc2)n1.
What is the InChIKey of 4-[3-[3,4-bis(trifluoromethyl)phenyl]-6-butylpyrazin-2-yl]benzoic acid?
The InChIKey is CPRVXKSCLWDSDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18F6N2O2/c1-2-3-4-16-12-30-19(20(31-16)13-5-7-14(8-6-13)21(32)33)15-9-10-17(22(24,25)26)18(11-15)23(27,28)29/h5-12H,2-4H2,1H3,(H,32,33).
What are the key properties of 4-[3-[3,4-bis(trifluoromethyl)phenyl]-6-butylpyrazin-2-yl]benzoic acid?
4-[3-[3,4-bis(trifluoromethyl)phenyl]-6-butylpyrazin-2-yl]benzoic acid has a molecular weight of 468.40 g/mol, XLogP of 6.89, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[3,4-bis(trifluoromethyl)phenyl]-6-butylpyrazin-2-yl]benzoic acid is sourced from PubChem (CID 138532474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).