C24H22F3NO4 — CID 138532499
4-[2-(4-methoxyphenyl)-5-[3-(2,2,2-trifluoroethoxy)propyl]-3-pyridinyl]benzoic acid (PubChem CID 138532499) has the molecular formula C24H22F3NO4 and a molecular weight of 445.44 g/mol. Its IUPAC name is 4-[2-(4-methoxyphenyl)-5-[3-(2,2,2-trifluoroethoxy)propyl]-3-pyridinyl]benzoic acid.
| Compound Name | 4-[2-(4-methoxyphenyl)-5-[3-(2,2,2-trifluoroethoxy)propyl]-3-pyridinyl]benzoic acid |
|---|---|
| PubChem CID | 138532499 |
| Molecular Formula | C24H22F3NO4 |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 4-[2-(4-methoxyphenyl)-5-[3-(2,2,2-trifluoroethoxy)propyl]-3-pyridinyl]benzoic acid |
| SMILES | COc1ccc(-c2ncc(CCCOCC(F)(F)F)cc2-c2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C24H22F3NO4/c1-31-20-10-8-18(9-11-20)22-21(17-4-6-19(7-5-17)23(29)30)13-16(14-28-22)3-2-12-32-15-24(25,26)27/h4-11,13-14H,2-3,12,15H2,1H3,(H,29,30) |
| InChIKey | UPECYRPLOLYPCW-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|