About 6-propyl-3,7-dihydro-2H-cyclopenta[c]pyridine
6-propyl-3,7-dihydro-2H-cyclopenta[c]pyridine (PubChem CID 138532966) has the molecular formula C11H15N
and a molecular weight of 161.25 g/mol. Its IUPAC name is 6-propyl-3,7-dihydro-2H-cyclopenta[c]pyridine.
Molecular Properties
| Compound Name | 6-propyl-3,7-dihydro-2H-cyclopenta[c]pyridine |
| PubChem CID | 138532966 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 6-propyl-3,7-dihydro-2H-cyclopenta[c]pyridine |
| SMILES | CCCC1=CC2=CCNC=C2C1 |
| InChI | InChI=1S/C11H15N/c1-2-3-9-6-10-4-5-12-8-11(10)7-9/h4,6,8,12H,2-3,5,7H2,1H3 |
| InChIKey | UGBVTWWLDXHCPD-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-propyl-3,7-dihydro-2H-cyclopenta[c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-propyl-3,7-dihydro-2H-cyclopenta[c]pyridine?
The IUPAC name of 6-propyl-3,7-dihydro-2H-cyclopenta[c]pyridine (CID 138532966) is 6-propyl-3,7-dihydro-2H-cyclopenta[c]pyridine.
What is the SMILES notation for 6-propyl-3,7-dihydro-2H-cyclopenta[c]pyridine?
The canonical SMILES for 6-propyl-3,7-dihydro-2H-cyclopenta[c]pyridine is CCCC1=CC2=CCNC=C2C1.
What is the InChIKey of 6-propyl-3,7-dihydro-2H-cyclopenta[c]pyridine?
The InChIKey is UGBVTWWLDXHCPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N/c1-2-3-9-6-10-4-5-12-8-11(10)7-9/h4,6,8,12H,2-3,5,7H2,1H3.
What are the key properties of 6-propyl-3,7-dihydro-2H-cyclopenta[c]pyridine?
6-propyl-3,7-dihydro-2H-cyclopenta[c]pyridine has a molecular weight of 161.25 g/mol, XLogP of 2.53, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-propyl-3,7-dihydro-2H-cyclopenta[c]pyridine is sourced from PubChem (CID 138532966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).