C12H17N — CID 138532970
2-[(1Z,3Z)-3-ethylpenta-1,3-dienyl]-3,4-dihydropyridine (PubChem CID 138532970) has the molecular formula C12H17N and a molecular weight of 175.27 g/mol. Its IUPAC name is 2-[(1Z,3Z)-3-ethylpenta-1,3-dienyl]-3,4-dihydropyridine.
| Compound Name | 2-[(1Z,3Z)-3-ethylpenta-1,3-dienyl]-3,4-dihydropyridine |
|---|---|
| PubChem CID | 138532970 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 2-[(1Z,3Z)-3-ethylpenta-1,3-dienyl]-3,4-dihydropyridine |
| SMILES | C/C=C(\C=C/C1=NC=CCC1)CC |
| InChI | InChI=1S/C12H17N/c1-3-11(4-2)8-9-12-7-5-6-10-13-12/h3,6,8-10H,4-5,7H2,1-2H3/b9-8-,11-3- |
| InChIKey | QHLIVCHXVUPUER-HCXSKGQGSA-N |
| XLogP | 3.65 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|