C32H53N — CID 138533260
6-(3-ethyl-4,5,6-trimethyloct-1-ynyl)-2-(4,5,6-trimethyloctan-3-yl)-3a,7a-dihydro-1H-indole (PubChem CID 138533260) has the molecular formula C32H53N and a molecular weight of 451.78 g/mol. Its IUPAC name is 6-(3-ethyl-4,5,6-trimethyloct-1-ynyl)-2-(4,5,6-trimethyloctan-3-yl)-3a,7a-dihydro-1H-indole.
| Compound Name | 6-(3-ethyl-4,5,6-trimethyloct-1-ynyl)-2-(4,5,6-trimethyloctan-3-yl)-3a,7a-dihydro-1H-indole |
|---|---|
| PubChem CID | 138533260 |
| Molecular Formula | C32H53N |
| Molecular Weight | 451.78 g/mol |
| Exact Mass | 451.42 |
| IUPAC Name | 6-(3-ethyl-4,5,6-trimethyloct-1-ynyl)-2-(4,5,6-trimethyloctan-3-yl)-3a,7a-dihydro-1H-indole |
| SMILES | CCC(C)C(C)C(C)C(C#CC1=CC2NC(C(CC)C(C)C(C)C(C)CC)=CC2C=C1)CC |
| InChI | InChI=1S/C32H53N/c1-11-21(5)23(7)25(9)28(13-3)17-15-27-16-18-29-20-32(33-31(29)19-27)30(14-4)26(10)24(8)22(6)12-2/h16,18-26,28-31,33H,11-14H2,1-10H3 |
| InChIKey | ZNXCTNFKDYJKRR-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.78 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|