C17H22N4O2 — CID 138533305
5-methyl-4-oxo-N-(2-piperazin-1-ylethyl)-1H-quinoline-2-carboxamide (PubChem CID 138533305) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 5-methyl-4-oxo-N-(2-piperazin-1-ylethyl)-1H-quinoline-2-carboxamide.
| Compound Name | 5-methyl-4-oxo-N-(2-piperazin-1-ylethyl)-1H-quinoline-2-carboxamide |
|---|---|
| PubChem CID | 138533305 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 5-methyl-4-oxo-N-(2-piperazin-1-ylethyl)-1H-quinoline-2-carboxamide |
| SMILES | Cc1cccc2[nH]c(C(=O)NCCN3CCNCC3)cc(=O)c12 |
| InChI | InChI=1S/C17H22N4O2/c1-12-3-2-4-13-16(12)15(22)11-14(20-13)17(23)19-7-10-21-8-5-18-6-9-21/h2-4,11,18H,5-10H2,1H3,(H,19,23)(H,20,22) |
| InChIKey | OVSOPWAQIRAFGP-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |