About 3,3-difluoro-2,7-dimethylisoindol-1-one
3,3-difluoro-2,7-dimethylisoindol-1-one (PubChem CID 138533359) has the molecular formula C10H9F2NO
and a molecular weight of 197.18 g/mol. Its IUPAC name is 3,3-difluoro-2,7-dimethylisoindol-1-one.
Molecular Properties
| Compound Name | 3,3-difluoro-2,7-dimethylisoindol-1-one |
| PubChem CID | 138533359 |
| Molecular Formula | C10H9F2NO |
| Molecular Weight | 197.18 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 3,3-difluoro-2,7-dimethylisoindol-1-one |
| SMILES | Cc1cccc2c1C(=O)N(C)C2(F)F |
| InChI | InChI=1S/C10H9F2NO/c1-6-4-3-5-7-8(6)9(14)13(2)10(7,11)12/h3-5H,1-2H3 |
| InChIKey | XJJMFXXNOUHGJI-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.18 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 3,3-difluoro-2,7-dimethylisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-difluoro-2,7-dimethylisoindol-1-one?
The IUPAC name of 3,3-difluoro-2,7-dimethylisoindol-1-one (CID 138533359) is 3,3-difluoro-2,7-dimethylisoindol-1-one.
What is the SMILES notation for 3,3-difluoro-2,7-dimethylisoindol-1-one?
The canonical SMILES for 3,3-difluoro-2,7-dimethylisoindol-1-one is Cc1cccc2c1C(=O)N(C)C2(F)F.
What is the InChIKey of 3,3-difluoro-2,7-dimethylisoindol-1-one?
The InChIKey is XJJMFXXNOUHGJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F2NO/c1-6-4-3-5-7-8(6)9(14)13(2)10(7,11)12/h3-5H,1-2H3.
What are the key properties of 3,3-difluoro-2,7-dimethylisoindol-1-one?
3,3-difluoro-2,7-dimethylisoindol-1-one has a molecular weight of 197.18 g/mol, XLogP of 2.13, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoro-2,7-dimethylisoindol-1-one is sourced from PubChem (CID 138533359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).