C23H40N4O2 — CID 138533892
3-[6-[bis(prop-2-enyl)carbamoylamino]-2,2,5-trimethylhexyl]-1,1-bis(prop-2-enyl)urea (PubChem CID 138533892) has the molecular formula C23H40N4O2 and a molecular weight of 404.60 g/mol. Its IUPAC name is 3-[6-[bis(prop-2-enyl)carbamoylamino]-2,2,5-trimethylhexyl]-1,1-bis(prop-2-enyl)urea.
| Compound Name | 3-[6-[bis(prop-2-enyl)carbamoylamino]-2,2,5-trimethylhexyl]-1,1-bis(prop-2-enyl)urea |
|---|---|
| PubChem CID | 138533892 |
| Molecular Formula | C23H40N4O2 |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.32 |
| IUPAC Name | 3-[6-[bis(prop-2-enyl)carbamoylamino]-2,2,5-trimethylhexyl]-1,1-bis(prop-2-enyl)urea |
| SMILES | C=CCN(CC=C)C(=O)NCC(C)CCC(C)(C)CNC(=O)N(CC=C)CC=C |
| InChI | InChI=1S/C23H40N4O2/c1-8-14-26(15-9-2)21(28)24-18-20(5)12-13-23(6,7)19-25-22(29)27(16-10-3)17-11-4/h8-11,20H,1-4,12-19H2,5-7H3,(H,24,28)(H,25,29) |
| InChIKey | DTPBNEQJKBSFFW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|