C23H34N6O2 — CID 138534564
8-(dimethylamino)-3-[2-(2-methoxyethylamino)pyrimidin-5-yl]-8-phenyl-1,3-diazaspiro[4.5]decan-2-ol (PubChem CID 138534564) has the molecular formula C23H34N6O2 and a molecular weight of 426.57 g/mol. Its IUPAC name is 8-(dimethylamino)-3-[2-(2-methoxyethylamino)pyrimidin-5-yl]-8-phenyl-1,3-diazaspiro[4.5]decan-2-ol.
| Compound Name | 8-(dimethylamino)-3-[2-(2-methoxyethylamino)pyrimidin-5-yl]-8-phenyl-1,3-diazaspiro[4.5]decan-2-ol |
|---|---|
| PubChem CID | 138534564 |
| Molecular Formula | C23H34N6O2 |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | 8-(dimethylamino)-3-[2-(2-methoxyethylamino)pyrimidin-5-yl]-8-phenyl-1,3-diazaspiro[4.5]decan-2-ol |
| SMILES | COCCNc1ncc(N2CC3(CCC(c4ccccc4)(N(C)C)CC3)NC2O)cn1 |
| InChI | InChI=1S/C23H34N6O2/c1-28(2)23(18-7-5-4-6-8-18)11-9-22(10-12-23)17-29(21(30)27-22)19-15-25-20(26-16-19)24-13-14-31-3/h4-8,15-16,21,27,30H,9-14,17H2,1-3H3,(H,24,25,26) |
| InChIKey | YTSWCHHCAKOCBY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 85.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|