C44H27F6N3O8S — CID 138534689
5-[2-[2-[4-[3-[3-(3-aminophenoxy)phenyl]sulfonylphenoxy]phenyl]-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylisoindole-1,3-dione (PubChem CID 138534689) has the molecular formula C44H27F6N3O8S and a molecular weight of 871.77 g/mol. Its IUPAC name is 5-[2-[2-[4-[3-[3-(3-aminophenoxy)phenyl]sulfonylphenoxy]phenyl]-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylisoindole-1,3-dione.
| Compound Name | 5-[2-[2-[4-[3-[3-(3-aminophenoxy)phenyl]sulfonylphenoxy]phenyl]-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylisoindole-1,3-dione |
|---|---|
| PubChem CID | 138534689 |
| Molecular Formula | C44H27F6N3O8S |
| Molecular Weight | 871.77 g/mol |
| Exact Mass | 871.14 |
| IUPAC Name | 5-[2-[2-[4-[3-[3-(3-aminophenoxy)phenyl]sulfonylphenoxy]phenyl]-1,3-dioxoisoindol-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-yl]-2-methylisoindole-1,3-dione |
| SMILES | CN1C(=O)c2ccc(C(c3ccc4c(c3)C(=O)N(c3ccc(Oc5cccc(S(=O)(=O)c6cccc(Oc7cccc(N)c7)c6)c5)cc3)C4=O)(C(F)(F)F)C(F)(F)F)cc2C1=O |
| InChI | InChI=1S/C44H27F6N3O8S/c1-52-38(54)34-17-11-24(19-36(34)39(52)55)42(43(45,46)47,44(48,49)50)25-12-18-35-37(20-25)41(57)53(40(35)56)27-13-15-28(16-14-27)60-30-7-3-9-32(22-30)62(58,59)33-10-4-8-31(23-33)61-29-6-2-5-26(51)21-29/h2-23H,51H2,1H3 |
| InChIKey | AARXULCRWYDQIZ-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 153.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.77 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|