C25H38F2O — CID 138534900
4-(4-butylcyclohexyl)-1-[(2Z,4Z)-6-ethoxy-4,5-difluorohepta-2,4,6-trien-3-yl]cyclohexene (PubChem CID 138534900) has the molecular formula C25H38F2O and a molecular weight of 392.57 g/mol. Its IUPAC name is 4-(4-butylcyclohexyl)-1-[(2Z,4Z)-6-ethoxy-4,5-difluorohepta-2,4,6-trien-3-yl]cyclohexene.
| Compound Name | 4-(4-butylcyclohexyl)-1-[(2Z,4Z)-6-ethoxy-4,5-difluorohepta-2,4,6-trien-3-yl]cyclohexene |
|---|---|
| PubChem CID | 138534900 |
| Molecular Formula | C25H38F2O |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.29 |
| IUPAC Name | 4-(4-butylcyclohexyl)-1-[(2Z,4Z)-6-ethoxy-4,5-difluorohepta-2,4,6-trien-3-yl]cyclohexene |
| SMILES | C=C(OCC)/C(F)=C(F)\C(=C/C)C1=CCC(C2CCC(CCCC)CC2)CC1 |
| InChI | InChI=1S/C25H38F2O/c1-5-8-9-19-10-12-20(13-11-19)21-14-16-22(17-15-21)23(6-2)25(27)24(26)18(4)28-7-3/h6,16,19-21H,4-5,7-15,17H2,1-3H3/b23-6-,25-24- |
| InChIKey | WSLUFHMOKUWJJH-QRVBGGETSA-N |
| XLogP | 8.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|