C14H22N2 — CID 138534945
1-tert-butyl-4,5,6-trimethyl-3a,4-dihydrobenzimidazole (PubChem CID 138534945) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 1-tert-butyl-4,5,6-trimethyl-3a,4-dihydrobenzimidazole.
| Compound Name | 1-tert-butyl-4,5,6-trimethyl-3a,4-dihydrobenzimidazole |
|---|---|
| PubChem CID | 138534945 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 1-tert-butyl-4,5,6-trimethyl-3a,4-dihydrobenzimidazole |
| SMILES | CC1=C(C)C(C)C2N=CN(C(C)(C)C)C2=C1 |
| InChI | InChI=1S/C14H22N2/c1-9-7-12-13(11(3)10(9)2)15-8-16(12)14(4,5)6/h7-8,11,13H,1-6H3 |
| InChIKey | BYAKKQVKIDCCRR-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |